C29H34N6O2 — CID 10625155
1-[3-[[3-[(N'-methyl-N-phenylcarbamimidoyl)amino]-2-oxo-4,5-dihydro-3H-1-benzazepin-1-yl]methyl]phenyl]-3-propan-2-ylurea (PubChem CID 10625155) has the molecular formula C29H34N6O2 and a molecular weight of 498.63 g/mol. Its IUPAC name is 1-[3-[[3-[(N'-methyl-N-phenylcarbamimidoyl)amino]-2-oxo-4,5-dihydro-3H-1-benzazepin-1-yl]methyl]phenyl]-3-propan-2-ylurea.
| Compound Name | 1-[3-[[3-[(N'-methyl-N-phenylcarbamimidoyl)amino]-2-oxo-4,5-dihydro-3H-1-benzazepin-1-yl]methyl]phenyl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 10625155 |
| Molecular Formula | C29H34N6O2 |
| Molecular Weight | 498.63 g/mol |
| Exact Mass | 498.27 |
| IUPAC Name | 1-[3-[[3-[(N'-methyl-N-phenylcarbamimidoyl)amino]-2-oxo-4,5-dihydro-3H-1-benzazepin-1-yl]methyl]phenyl]-3-propan-2-ylurea |
| SMILES | C/N=C(\Nc1ccccc1)NC1CCc2ccccc2N(Cc2cccc(NC(=O)NC(C)C)c2)C1=O |
| InChI | InChI=1S/C29H34N6O2/c1-20(2)31-29(37)33-24-14-9-10-21(18-24)19-35-26-15-8-7-11-22(26)16-17-25(27(35)36)34-28(30-3)32-23-12-5-4-6-13-23/h4-15,18,20,25H,16-17,19H2,1-3H3,(H2,30,32,34)(H2,31,33,37) |
| InChIKey | QXXWNMDFYAQKKE-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 97.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.63 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|