C30H35NO4Si — CID 10625243
(4S,5R)-3-[4-[tert-butyl(diphenyl)silyl]oxybutanoyl]-4-methyl-5-phenyl-1,3-oxazolidin-2-one (PubChem CID 10625243) has the molecular formula C30H35NO4Si and a molecular weight of 501.70 g/mol. Its IUPAC name is (4S,5R)-3-[4-[tert-butyl(diphenyl)silyl]oxybutanoyl]-4-methyl-5-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4S,5R)-3-[4-[tert-butyl(diphenyl)silyl]oxybutanoyl]-4-methyl-5-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 10625243 |
| Molecular Formula | C30H35NO4Si |
| Molecular Weight | 501.70 g/mol |
| Exact Mass | 501.23 |
| IUPAC Name | (4S,5R)-3-[4-[tert-butyl(diphenyl)silyl]oxybutanoyl]-4-methyl-5-phenyl-1,3-oxazolidin-2-one |
| SMILES | C[C@H]1[C@@H](c2ccccc2)OC(=O)N1C(=O)CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C30H35NO4Si/c1-23-28(24-15-8-5-9-16-24)35-29(33)31(23)27(32)21-14-22-34-36(30(2,3)4,25-17-10-6-11-18-25)26-19-12-7-13-20-26/h5-13,15-20,23,28H,14,21-22H2,1-4H3/t23-,28-/m0/s1 |
| InChIKey | SCFGUKBTTBRBLS-FIPFOOKPSA-N |
| XLogP | 5.45 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.70 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|