C22H35ClN4O5S — CID 10625292
(4R,5S,6S)-3-[(3S,5S)-5-(4,4-dimethyl-1,4-diazepan-4-ium-1-carbonyl)pyrrolidin-3-yl]sulfanyl-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid chloride (PubChem CID 10625292) has the molecular formula C22H35ClN4O5S and a molecular weight of 503.07 g/mol. Its IUPAC name is (4R,5S,6S)-3-[(3S,5S)-5-(4,4-dimethyl-1,4-diazepan-4-ium-1-carbonyl)pyrrolidin-3-yl]sulfanyl-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid chloride.
| Compound Name | (4R,5S,6S)-3-[(3S,5S)-5-(4,4-dimethyl-1,4-diazepan-4-ium-1-carbonyl)pyrrolidin-3-yl]sulfanyl-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid chloride |
|---|---|
| PubChem CID | 10625292 |
| Molecular Formula | C22H35ClN4O5S |
| Molecular Weight | 503.07 g/mol |
| Exact Mass | 502.20 |
| IUPAC Name | (4R,5S,6S)-3-[(3S,5S)-5-(4,4-dimethyl-1,4-diazepan-4-ium-1-carbonyl)pyrrolidin-3-yl]sulfanyl-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid chloride |
| SMILES | C[C@@H](O)[C@H]1C(=O)N2C(C(=O)O)=C(S[C@@H]3CN[C@H](C(=O)N4CCC[N+](C)(C)CC4)C3)[C@H](C)[C@H]12.[Cl-] |
| InChI | InChI=1S/C22H34N4O5S.ClH/c1-12-17-16(13(2)27)21(29)25(17)18(22(30)31)19(12)32-14-10-15(23-11-14)20(28)24-6-5-8-26(3,4)9-7-24;/h12-17,23,27H,5-11H2,1-4H3;1H/t12-,13-,14+,15+,16-,17-;/m1./s1 |
| InChIKey | BGZVYYLPIQTVJK-VMPGBSFBSA-N |
| XLogP | -3.08 |
| TPSA | 110.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.07 |
| LogP ≤ 5 | -3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|