C16H22ClNO2 — CID 106253171
N-[2-(chloromethyl)-2-ethylbutyl]-2,3-dihydro-1-benzofuran-5-carboxamide (PubChem CID 106253171) has the molecular formula C16H22ClNO2 and a molecular weight of 295.81 g/mol. Its IUPAC name is N-[2-(chloromethyl)-2-ethylbutyl]-2,3-dihydro-1-benzofuran-5-carboxamide.
| Compound Name | N-[2-(chloromethyl)-2-ethylbutyl]-2,3-dihydro-1-benzofuran-5-carboxamide |
|---|---|
| PubChem CID | 106253171 |
| Molecular Formula | C16H22ClNO2 |
| Molecular Weight | 295.81 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | N-[2-(chloromethyl)-2-ethylbutyl]-2,3-dihydro-1-benzofuran-5-carboxamide |
| SMILES | CCC(CC)(CCl)CNC(=O)c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C16H22ClNO2/c1-3-16(4-2,10-17)11-18-15(19)13-5-6-14-12(9-13)7-8-20-14/h5-6,9H,3-4,7-8,10-11H2,1-2H3,(H,18,19) |
| InChIKey | WZTYLLRLGRTEHB-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.81 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|