C15H21Cl2NO — CID 106253389
2-(2,5-dichlorophenyl)-6,6-diethyl-1,4-oxazepane (PubChem CID 106253389) has the molecular formula C15H21Cl2NO and a molecular weight of 302.24 g/mol. Its IUPAC name is 2-(2,5-dichlorophenyl)-6,6-diethyl-1,4-oxazepane.
| Compound Name | 2-(2,5-dichlorophenyl)-6,6-diethyl-1,4-oxazepane |
|---|---|
| PubChem CID | 106253389 |
| Molecular Formula | C15H21Cl2NO |
| Molecular Weight | 302.24 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 2-(2,5-dichlorophenyl)-6,6-diethyl-1,4-oxazepane |
| SMILES | CCC1(CC)CNCC(c2cc(Cl)ccc2Cl)OC1 |
| InChI | InChI=1S/C15H21Cl2NO/c1-3-15(4-2)9-18-8-14(19-10-15)12-7-11(16)5-6-13(12)17/h5-7,14,18H,3-4,8-10H2,1-2H3 |
| InChIKey | SKQPHHYCWZVVON-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.24 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |