C12H26N2O3 — CID 106254861
3-(aminomethyl)-N-(2-hydroxy-4-methoxy-2-methylbutyl)pentanamide (PubChem CID 106254861) has the molecular formula C12H26N2O3 and a molecular weight of 246.35 g/mol. Its IUPAC name is 3-(aminomethyl)-N-(2-hydroxy-4-methoxy-2-methylbutyl)pentanamide.
| Compound Name | 3-(aminomethyl)-N-(2-hydroxy-4-methoxy-2-methylbutyl)pentanamide |
|---|---|
| PubChem CID | 106254861 |
| Molecular Formula | C12H26N2O3 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.19 |
| IUPAC Name | 3-(aminomethyl)-N-(2-hydroxy-4-methoxy-2-methylbutyl)pentanamide |
| SMILES | CCC(CN)CC(=O)NCC(C)(O)CCOC |
| InChI | InChI=1S/C12H26N2O3/c1-4-10(8-13)7-11(15)14-9-12(2,16)5-6-17-3/h10,16H,4-9,13H2,1-3H3,(H,14,15) |
| InChIKey | XQZIWAGXJOPZRW-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |