C29H54O5Si — CID 10625540
methyl (5S,6Z,8E)-5-[tert-butyl(dimethyl)silyl]oxy-11-(2-octyl-1,3-dioxolan-2-yl)undeca-6,8-dienoate (PubChem CID 10625540) has the molecular formula C29H54O5Si and a molecular weight of 510.83 g/mol. Its IUPAC name is methyl (5S,6Z,8E)-5-[tert-butyl(dimethyl)silyl]oxy-11-(2-octyl-1,3-dioxolan-2-yl)undeca-6,8-dienoate.
| Compound Name | methyl (5S,6Z,8E)-5-[tert-butyl(dimethyl)silyl]oxy-11-(2-octyl-1,3-dioxolan-2-yl)undeca-6,8-dienoate |
|---|---|
| PubChem CID | 10625540 |
| Molecular Formula | C29H54O5Si |
| Molecular Weight | 510.83 g/mol |
| Exact Mass | 510.37 |
| IUPAC Name | methyl (5S,6Z,8E)-5-[tert-butyl(dimethyl)silyl]oxy-11-(2-octyl-1,3-dioxolan-2-yl)undeca-6,8-dienoate |
| SMILES | CCCCCCCCC1(CC/C=C/C=C\[C@H](CCCC(=O)OC)O[Si](C)(C)C(C)(C)C)OCCO1 |
| InChI | InChI=1S/C29H54O5Si/c1-8-9-10-11-13-16-22-29(32-24-25-33-29)23-17-14-12-15-19-26(20-18-21-27(30)31-5)34-35(6,7)28(2,3)4/h12,14-15,19,26H,8-11,13,16-18,20-25H2,1-7H3/b14-12+,19-15-/t26-/m1/s1 |
| InChIKey | ARBXOENNFSERDN-GPUTXQHMSA-N |
| XLogP | 8.11 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.83 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|