About 4-[2-(2,6-diphenylpyridin-1-ium-1-yl)ethyl]benzenesulfonamide perchlorate
4-[2-(2,6-diphenylpyridin-1-ium-1-yl)ethyl]benzenesulfonamide perchlorate (PubChem CID 10625651) has the molecular formula C25H23ClN2O6S
and a molecular weight of 514.99 g/mol. Its IUPAC name is 4-[2-(2,6-diphenylpyridin-1-ium-1-yl)ethyl]benzenesulfonamide perchlorate.
Molecular Properties
| Compound Name | 4-[2-(2,6-diphenylpyridin-1-ium-1-yl)ethyl]benzenesulfonamide perchlorate |
| PubChem CID | 10625651 |
| Molecular Formula | C25H23ClN2O6S |
| Molecular Weight | 514.99 g/mol |
| Exact Mass | 514.10 |
| IUPAC Name | 4-[2-(2,6-diphenylpyridin-1-ium-1-yl)ethyl]benzenesulfonamide perchlorate |
| SMILES | NS(=O)(=O)c1ccc(CC[n+]2c(-c3ccccc3)cccc2-c2ccccc2)cc1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C25H23N2O2S.ClHO4/c26-30(28,29)23-16-14-20(15-17-23)18-19-27-24(21-8-3-1-4-9-21)12-7-13-25(27)22-10-5-2-6-11-22;2-1(3,4)5/h1-17H,18-19H2,(H2,26,28,29);(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | RXJZFOGOOASTHW-UHFFFAOYSA-M |
| XLogP | -0.56 |
| TPSA | 156.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 514.99 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-(2,6-diphenylpyridin-1-ium-1-yl)ethyl]benzenesulfonamide perchlorate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(2,6-diphenylpyridin-1-ium-1-yl)ethyl]benzenesulfonamide perchlorate?
The IUPAC name of 4-[2-(2,6-diphenylpyridin-1-ium-1-yl)ethyl]benzenesulfonamide perchlorate (CID 10625651) is 4-[2-(2,6-diphenylpyridin-1-ium-1-yl)ethyl]benzenesulfonamide perchlorate.
What is the SMILES notation for 4-[2-(2,6-diphenylpyridin-1-ium-1-yl)ethyl]benzenesulfonamide perchlorate?
The canonical SMILES for 4-[2-(2,6-diphenylpyridin-1-ium-1-yl)ethyl]benzenesulfonamide perchlorate is NS(=O)(=O)c1ccc(CC[n+]2c(-c3ccccc3)cccc2-c2ccccc2)cc1.[O-][Cl+3]([O-])([O-])[O-].
What is the InChIKey of 4-[2-(2,6-diphenylpyridin-1-ium-1-yl)ethyl]benzenesulfonamide perchlorate?
The InChIKey is RXJZFOGOOASTHW-UHFFFAOYSA-M. The full InChI is InChI=1S/C25H23N2O2S.ClHO4/c26-30(28,29)23-16-14-20(15-17-23)18-19-27-24(21-8-3-1-4-9-21)12-7-13-25(27)22-10-5-2-6-11-22;2-1(3,4)5/h1-17H,18-19H2,(H2,26,28,29);(H,2,3,4,5)/q+1;/p-1.
What are the key properties of 4-[2-(2,6-diphenylpyridin-1-ium-1-yl)ethyl]benzenesulfonamide perchlorate?
4-[2-(2,6-diphenylpyridin-1-ium-1-yl)ethyl]benzenesulfonamide perchlorate has a molecular weight of 514.99 g/mol, XLogP of -0.56, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(2,6-diphenylpyridin-1-ium-1-yl)ethyl]benzenesulfonamide perchlorate is sourced from PubChem (CID 10625651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).