C17H19N5O10P2 — CID 10625659
[(2R,3S,5R)-5-(6-benzamidopurin-9-yl)-2-(phosphonooxymethyl)oxolan-3-yl] dihydrogen phosphate (PubChem CID 10625659) has the molecular formula C17H19N5O10P2 and a molecular weight of 515.31 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(6-benzamidopurin-9-yl)-2-(phosphonooxymethyl)oxolan-3-yl] dihydrogen phosphate.
| Compound Name | [(2R,3S,5R)-5-(6-benzamidopurin-9-yl)-2-(phosphonooxymethyl)oxolan-3-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 10625659 |
| Molecular Formula | C17H19N5O10P2 |
| Molecular Weight | 515.31 g/mol |
| Exact Mass | 515.06 |
| IUPAC Name | [(2R,3S,5R)-5-(6-benzamidopurin-9-yl)-2-(phosphonooxymethyl)oxolan-3-yl] dihydrogen phosphate |
| SMILES | O=C(Nc1ncnc2c1ncn2[C@H]1C[C@H](OP(=O)(O)O)[C@@H](COP(=O)(O)O)O1)c1ccccc1 |
| InChI | InChI=1S/C17H19N5O10P2/c23-17(10-4-2-1-3-5-10)21-15-14-16(19-8-18-15)22(9-20-14)13-6-11(32-34(27,28)29)12(31-13)7-30-33(24,25)26/h1-5,8-9,11-13H,6-7H2,(H2,24,25,26)(H2,27,28,29)(H,18,19,21,23)/t11-,12+,13+/m0/s1 |
| InChIKey | ZVPXZZWPAATWSC-YNEHKIRRSA-N |
| XLogP | 0.95 |
| TPSA | 215.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.31 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|