C22H9F4N5O6 — CID 10625660
(4-azido-2,3,5,6-tetrafluorophenyl)methyl 3,5-bis(2,5-dioxopyrrol-1-yl)benzoate (PubChem CID 10625660) has the molecular formula C22H9F4N5O6 and a molecular weight of 515.34 g/mol. Its IUPAC name is (4-azido-2,3,5,6-tetrafluorophenyl)methyl 3,5-bis(2,5-dioxopyrrol-1-yl)benzoate.
| Compound Name | (4-azido-2,3,5,6-tetrafluorophenyl)methyl 3,5-bis(2,5-dioxopyrrol-1-yl)benzoate |
|---|---|
| PubChem CID | 10625660 |
| Molecular Formula | C22H9F4N5O6 |
| Molecular Weight | 515.34 g/mol |
| Exact Mass | 515.05 |
| IUPAC Name | (4-azido-2,3,5,6-tetrafluorophenyl)methyl 3,5-bis(2,5-dioxopyrrol-1-yl)benzoate |
| SMILES | [N-]=[N+]=Nc1c(F)c(F)c(COC(=O)c2cc(N3C(=O)C=CC3=O)cc(N3C(=O)C=CC3=O)c2)c(F)c1F |
| InChI | InChI=1S/C22H9F4N5O6/c23-17-12(18(24)20(26)21(19(17)25)28-29-27)8-37-22(36)9-5-10(30-13(32)1-2-14(30)33)7-11(6-9)31-15(34)3-4-16(31)35/h1-7H,8H2 |
| InChIKey | LDRJVYROWBSEMY-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 149.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.34 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|