C18H20N5O3S2+ — CID 10625733
2-(2,6-dimethyl-4-phenylpyridin-1-ium-1-yl)-N-(3-methyl-5-sulfamoyl-1,3,4-thiadiazol-2-ylidene)acetamide (PubChem CID 10625733) has the molecular formula C18H20N5O3S2+ and a molecular weight of 418.52 g/mol. Its IUPAC name is 2-(2,6-dimethyl-4-phenylpyridin-1-ium-1-yl)-N-(3-methyl-5-sulfamoyl-1,3,4-thiadiazol-2-ylidene)acetamide.
| Compound Name | 2-(2,6-dimethyl-4-phenylpyridin-1-ium-1-yl)-N-(3-methyl-5-sulfamoyl-1,3,4-thiadiazol-2-ylidene)acetamide |
|---|---|
| PubChem CID | 10625733 |
| Molecular Formula | C18H20N5O3S2+ |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | 2-(2,6-dimethyl-4-phenylpyridin-1-ium-1-yl)-N-(3-methyl-5-sulfamoyl-1,3,4-thiadiazol-2-ylidene)acetamide |
| SMILES | Cc1cc(-c2ccccc2)cc(C)[n+]1CC(=O)/N=c1\sc(S(N)(=O)=O)nn1C |
| InChI | InChI=1S/C18H20N5O3S2/c1-12-9-15(14-7-5-4-6-8-14)10-13(2)23(12)11-16(24)20-17-22(3)21-18(27-17)28(19,25)26/h4-10H,11H2,1-3H3,(H2,19,25,26)/q+1/b20-17- |
| InChIKey | UWIGEYBKDHPGMV-JZJYNLBNSA-N |
| XLogP | 0.83 |
| TPSA | 111.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|