C12H15FN4O2S2 — CID 106259711
3-amino-4-fluoro-N-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]benzenesulfonamide (PubChem CID 106259711) has the molecular formula C12H15FN4O2S2 and a molecular weight of 330.41 g/mol. Its IUPAC name is 3-amino-4-fluoro-N-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]benzenesulfonamide.
| Compound Name | 3-amino-4-fluoro-N-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 106259711 |
| Molecular Formula | C12H15FN4O2S2 |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | 3-amino-4-fluoro-N-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]benzenesulfonamide |
| SMILES | CC(C)Cc1nnc(NS(=O)(=O)c2ccc(F)c(N)c2)s1 |
| InChI | InChI=1S/C12H15FN4O2S2/c1-7(2)5-11-15-16-12(20-11)17-21(18,19)8-3-4-9(13)10(14)6-8/h3-4,6-7H,5,14H2,1-2H3,(H,16,17) |
| InChIKey | RHLZZRBLJWWDDD-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|