C8H13NO2 — CID 10626
7-(hydroxymethyl)-2,3,5,8-tetrahydro-1H-pyrrolizin-1-ol (PubChem CID 10626) has the molecular formula C8H13NO2 and a molecular weight of 155.20 g/mol. Its IUPAC name is 7-(hydroxymethyl)-2,3,5,8-tetrahydro-1H-pyrrolizin-1-ol.
| Compound Name | 7-(hydroxymethyl)-2,3,5,8-tetrahydro-1H-pyrrolizin-1-ol |
|---|---|
| PubChem CID | 10626 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | 7-(hydroxymethyl)-2,3,5,8-tetrahydro-1H-pyrrolizin-1-ol |
| SMILES | OCC1=CCN2CCC(O)C12 |
| InChI | InChI=1S/C8H13NO2/c10-5-6-1-3-9-4-2-7(11)8(6)9/h1,7-8,10-11H,2-5H2 |
| InChIKey | HJSJELVDQOXCHO-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|