C13H18BrNO2 — CID 106260338
2-bromo-N-[2-(2-methoxyphenyl)ethyl]butanamide (PubChem CID 106260338) has the molecular formula C13H18BrNO2 and a molecular weight of 300.20 g/mol. Its IUPAC name is 2-bromo-N-[2-(2-methoxyphenyl)ethyl]butanamide.
| Compound Name | 2-bromo-N-[2-(2-methoxyphenyl)ethyl]butanamide |
|---|---|
| PubChem CID | 106260338 |
| Molecular Formula | C13H18BrNO2 |
| Molecular Weight | 300.20 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | 2-bromo-N-[2-(2-methoxyphenyl)ethyl]butanamide |
| SMILES | CCC(Br)C(=O)NCCc1ccccc1OC |
| InChI | InChI=1S/C13H18BrNO2/c1-3-11(14)13(16)15-9-8-10-6-4-5-7-12(10)17-2/h4-7,11H,3,8-9H2,1-2H3,(H,15,16) |
| InChIKey | VXTZYGSMFFNVCN-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.20 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|