C10H16ClN3OS — CID 106260360
3-chloro-2-methyl-N-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]propanamide (PubChem CID 106260360) has the molecular formula C10H16ClN3OS and a molecular weight of 261.78 g/mol. Its IUPAC name is 3-chloro-2-methyl-N-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]propanamide.
| Compound Name | 3-chloro-2-methyl-N-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 106260360 |
| Molecular Formula | C10H16ClN3OS |
| Molecular Weight | 261.78 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | 3-chloro-2-methyl-N-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]propanamide |
| SMILES | CC(C)Cc1nnc(NC(=O)C(C)CCl)s1 |
| InChI | InChI=1S/C10H16ClN3OS/c1-6(2)4-8-13-14-10(16-8)12-9(15)7(3)5-11/h6-7H,4-5H2,1-3H3,(H,12,14,15) |
| InChIKey | QKWXHXNCQFAZRO-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.78 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|