C11H15N3O2S — CID 106260432
6-(methoxymethyl)-2-(2-methylpropyl)imidazo[2,1-b][1,3,4]thiadiazole-5-carbaldehyde (PubChem CID 106260432) has the molecular formula C11H15N3O2S and a molecular weight of 253.33 g/mol. Its IUPAC name is 6-(methoxymethyl)-2-(2-methylpropyl)imidazo[2,1-b][1,3,4]thiadiazole-5-carbaldehyde.
| Compound Name | 6-(methoxymethyl)-2-(2-methylpropyl)imidazo[2,1-b][1,3,4]thiadiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 106260432 |
| Molecular Formula | C11H15N3O2S |
| Molecular Weight | 253.33 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 6-(methoxymethyl)-2-(2-methylpropyl)imidazo[2,1-b][1,3,4]thiadiazole-5-carbaldehyde |
| SMILES | COCc1nc2sc(CC(C)C)nn2c1C=O |
| InChI | InChI=1S/C11H15N3O2S/c1-7(2)4-10-13-14-9(5-15)8(6-16-3)12-11(14)17-10/h5,7H,4,6H2,1-3H3 |
| InChIKey | FEYBORMPYGHHSL-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.33 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|