C28H29N5O6 — CID 10626081
N-[3-[[4-[3-(hydroxyamino)propylamino]-9,10-dioxoanthracen-1-yl]amino]propyl]-2-(2-nitrophenyl)acetamide (PubChem CID 10626081) has the molecular formula C28H29N5O6 and a molecular weight of 531.57 g/mol. Its IUPAC name is N-[3-[[4-[3-(hydroxyamino)propylamino]-9,10-dioxoanthracen-1-yl]amino]propyl]-2-(2-nitrophenyl)acetamide.
| Compound Name | N-[3-[[4-[3-(hydroxyamino)propylamino]-9,10-dioxoanthracen-1-yl]amino]propyl]-2-(2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 10626081 |
| Molecular Formula | C28H29N5O6 |
| Molecular Weight | 531.57 g/mol |
| Exact Mass | 531.21 |
| IUPAC Name | N-[3-[[4-[3-(hydroxyamino)propylamino]-9,10-dioxoanthracen-1-yl]amino]propyl]-2-(2-nitrophenyl)acetamide |
| SMILES | O=C(Cc1ccccc1[N+](=O)[O-])NCCCNc1ccc(NCCCNO)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C28H29N5O6/c34-24(17-18-7-1-4-10-23(18)33(38)39)31-15-5-13-29-21-11-12-22(30-14-6-16-32-37)26-25(21)27(35)19-8-2-3-9-20(19)28(26)36/h1-4,7-12,29-30,32,37H,5-6,13-17H2,(H,31,34) |
| InChIKey | NEKUCJHYMZKNHK-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 162.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.57 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|