About [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] (E)-3-triphenylstannylprop-2-enoate
[(3R)-4,4-dimethyl-2-oxooxolan-3-yl] (E)-3-triphenylstannylprop-2-enoate (PubChem CID 10626115) has the molecular formula C27H26O4Sn
and a molecular weight of 533.21 g/mol. Its IUPAC name is [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] (E)-3-triphenylstannylprop-2-enoate.
Molecular Properties
| Compound Name | [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] (E)-3-triphenylstannylprop-2-enoate |
| PubChem CID | 10626115 |
| Molecular Formula | C27H26O4Sn |
| Molecular Weight | 533.21 g/mol |
| Exact Mass | 534.09 |
| IUPAC Name | [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] (E)-3-triphenylstannylprop-2-enoate |
| SMILES | CC1(C)COC(=O)[C@@H]1OC(=O)/C=C/[Sn](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C9H11O4.3C6H5.Sn/c1-4-6(10)13-7-8(11)12-5-9(7,2)3;3*1-2-4-6-5-3-1;/h1,4,7H,5H2,2-3H3;3*1-5H;/t7-;;;;/m0..../s1 |
| InChIKey | ZRJIWJQADSUXQJ-HEDVWWMMSA-N |
| XLogP | 2.75 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 533.21 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] (E)-3-triphenylstannylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] (E)-3-triphenylstannylprop-2-enoate?
The IUPAC name of [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] (E)-3-triphenylstannylprop-2-enoate (CID 10626115) is [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] (E)-3-triphenylstannylprop-2-enoate.
What is the SMILES notation for [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] (E)-3-triphenylstannylprop-2-enoate?
The canonical SMILES for [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] (E)-3-triphenylstannylprop-2-enoate is CC1(C)COC(=O)[C@@H]1OC(=O)/C=C/[Sn](c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] (E)-3-triphenylstannylprop-2-enoate?
The InChIKey is ZRJIWJQADSUXQJ-HEDVWWMMSA-N. The full InChI is InChI=1S/C9H11O4.3C6H5.Sn/c1-4-6(10)13-7-8(11)12-5-9(7,2)3;3*1-2-4-6-5-3-1;/h1,4,7H,5H2,2-3H3;3*1-5H;/t7-;;;;/m0..../s1.
What are the key properties of [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] (E)-3-triphenylstannylprop-2-enoate?
[(3R)-4,4-dimethyl-2-oxooxolan-3-yl] (E)-3-triphenylstannylprop-2-enoate has a molecular weight of 533.21 g/mol, XLogP of 2.75, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] (E)-3-triphenylstannylprop-2-enoate is sourced from PubChem (CID 10626115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).