C24H45IO3Si — CID 10626189
tert-butyl-[[(2R,3S,6R,8R,10S)-8-[(E)-4-iodo-3-methylbut-2-enyl]-3-methyl-2-propan-2-yl-1,7-dioxaspiro[5.5]undecan-10-yl]oxy]-dimethylsilane (PubChem CID 10626189) has the molecular formula C24H45IO3Si and a molecular weight of 536.61 g/mol. Its IUPAC name is tert-butyl-[[(2R,3S,6R,8R,10S)-8-[(E)-4-iodo-3-methylbut-2-enyl]-3-methyl-2-propan-2-yl-1,7-dioxaspiro[5.5]undecan-10-yl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(2R,3S,6R,8R,10S)-8-[(E)-4-iodo-3-methylbut-2-enyl]-3-methyl-2-propan-2-yl-1,7-dioxaspiro[5.5]undecan-10-yl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 10626189 |
| Molecular Formula | C24H45IO3Si |
| Molecular Weight | 536.61 g/mol |
| Exact Mass | 536.22 |
| IUPAC Name | tert-butyl-[[(2R,3S,6R,8R,10S)-8-[(E)-4-iodo-3-methylbut-2-enyl]-3-methyl-2-propan-2-yl-1,7-dioxaspiro[5.5]undecan-10-yl]oxy]-dimethylsilane |
| SMILES | C/C(=C\C[C@@H]1C[C@H](O[Si](C)(C)C(C)(C)C)C[C@]2(CC[C@H](C)[C@@H](C(C)C)O2)O1)CI |
| InChI | InChI=1S/C24H45IO3Si/c1-17(2)22-19(4)12-13-24(27-22)15-21(28-29(8,9)23(5,6)7)14-20(26-24)11-10-18(3)16-25/h10,17,19-22H,11-16H2,1-9H3/b18-10+/t19-,20+,21-,22+,24+/m0/s1 |
| InChIKey | ZTJXDAAIIWIBJB-UDHSLDDKSA-N |
| XLogP | 7.49 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.61 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|