C16H26N2O — CID 106261953
1-[2-(2-methoxyphenyl)ethyl]-4-methyl-1,5-diazocane (PubChem CID 106261953) has the molecular formula C16H26N2O and a molecular weight of 262.40 g/mol. Its IUPAC name is 1-[2-(2-methoxyphenyl)ethyl]-4-methyl-1,5-diazocane.
| Compound Name | 1-[2-(2-methoxyphenyl)ethyl]-4-methyl-1,5-diazocane |
|---|---|
| PubChem CID | 106261953 |
| Molecular Formula | C16H26N2O |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.20 |
| IUPAC Name | 1-[2-(2-methoxyphenyl)ethyl]-4-methyl-1,5-diazocane |
| SMILES | COc1ccccc1CCN1CCCNC(C)CC1 |
| InChI | InChI=1S/C16H26N2O/c1-14-8-12-18(11-5-10-17-14)13-9-15-6-3-4-7-16(15)19-2/h3-4,6-7,14,17H,5,8-13H2,1-2H3 |
| InChIKey | BSDVHCBNFXGXRI-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |