C13H16BrN5O — CID 106262742
5-bromo-6-hydrazinyl-N-[2-(2-methoxyphenyl)ethyl]pyrimidin-4-amine (PubChem CID 106262742) has the molecular formula C13H16BrN5O and a molecular weight of 338.21 g/mol. Its IUPAC name is 5-bromo-6-hydrazinyl-N-[2-(2-methoxyphenyl)ethyl]pyrimidin-4-amine.
| Compound Name | 5-bromo-6-hydrazinyl-N-[2-(2-methoxyphenyl)ethyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 106262742 |
| Molecular Formula | C13H16BrN5O |
| Molecular Weight | 338.21 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | 5-bromo-6-hydrazinyl-N-[2-(2-methoxyphenyl)ethyl]pyrimidin-4-amine |
| SMILES | COc1ccccc1CCNc1ncnc(NN)c1Br |
| InChI | InChI=1S/C13H16BrN5O/c1-20-10-5-3-2-4-9(10)6-7-16-12-11(14)13(19-15)18-8-17-12/h2-5,8H,6-7,15H2,1H3,(H2,16,17,18,19) |
| InChIKey | BYFPVYXKZIIQSL-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.21 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|