About phenyl-(2,5,6-tribenzoyl-4-sulfanylidenethiopyran-3-yl)methanone
phenyl-(2,5,6-tribenzoyl-4-sulfanylidenethiopyran-3-yl)methanone (PubChem CID 10626363) has the molecular formula C33H20O4S2
and a molecular weight of 544.65 g/mol. Its IUPAC name is phenyl-(2,5,6-tribenzoyl-4-sulfanylidenethiopyran-3-yl)methanone.
Molecular Properties
| Compound Name | phenyl-(2,5,6-tribenzoyl-4-sulfanylidenethiopyran-3-yl)methanone |
| PubChem CID | 10626363 |
| Molecular Formula | C33H20O4S2 |
| Molecular Weight | 544.65 g/mol |
| Exact Mass | 544.08 |
| IUPAC Name | phenyl-(2,5,6-tribenzoyl-4-sulfanylidenethiopyran-3-yl)methanone |
| SMILES | O=C(c1ccccc1)c1sc(C(=O)c2ccccc2)c(C(=O)c2ccccc2)c(=S)c1C(=O)c1ccccc1 |
| InChI | InChI=1S/C33H20O4S2/c34-27(21-13-5-1-6-14-21)25-31(38)26(28(35)22-15-7-2-8-16-22)33(30(37)24-19-11-4-12-20-24)39-32(25)29(36)23-17-9-3-10-18-23/h1-20H |
| InChIKey | LKNDOWGIHGPPIB-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 544.65 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze phenyl-(2,5,6-tribenzoyl-4-sulfanylidenethiopyran-3-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl-(2,5,6-tribenzoyl-4-sulfanylidenethiopyran-3-yl)methanone?
The IUPAC name of phenyl-(2,5,6-tribenzoyl-4-sulfanylidenethiopyran-3-yl)methanone (CID 10626363) is phenyl-(2,5,6-tribenzoyl-4-sulfanylidenethiopyran-3-yl)methanone.
What is the SMILES notation for phenyl-(2,5,6-tribenzoyl-4-sulfanylidenethiopyran-3-yl)methanone?
The canonical SMILES for phenyl-(2,5,6-tribenzoyl-4-sulfanylidenethiopyran-3-yl)methanone is O=C(c1ccccc1)c1sc(C(=O)c2ccccc2)c(C(=O)c2ccccc2)c(=S)c1C(=O)c1ccccc1.
What is the InChIKey of phenyl-(2,5,6-tribenzoyl-4-sulfanylidenethiopyran-3-yl)methanone?
The InChIKey is LKNDOWGIHGPPIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H20O4S2/c34-27(21-13-5-1-6-14-21)25-31(38)26(28(35)22-15-7-2-8-16-22)33(30(37)24-19-11-4-12-20-24)39-32(25)29(36)23-17-9-3-10-18-23/h1-20H.
What are the key properties of phenyl-(2,5,6-tribenzoyl-4-sulfanylidenethiopyran-3-yl)methanone?
phenyl-(2,5,6-tribenzoyl-4-sulfanylidenethiopyran-3-yl)methanone has a molecular weight of 544.65 g/mol, XLogP of 7.40, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl-(2,5,6-tribenzoyl-4-sulfanylidenethiopyran-3-yl)methanone is sourced from PubChem (CID 10626363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).