C13H7BrClF4N — CID 106263674
N-[(3-bromo-2,6-difluorophenyl)methyl]-2-chloro-4,6-difluoroaniline (PubChem CID 106263674) has the molecular formula C13H7BrClF4N and a molecular weight of 368.56 g/mol. Its IUPAC name is N-[(3-bromo-2,6-difluorophenyl)methyl]-2-chloro-4,6-difluoroaniline.
| Compound Name | N-[(3-bromo-2,6-difluorophenyl)methyl]-2-chloro-4,6-difluoroaniline |
|---|---|
| PubChem CID | 106263674 |
| Molecular Formula | C13H7BrClF4N |
| Molecular Weight | 368.56 g/mol |
| Exact Mass | 366.94 |
| IUPAC Name | N-[(3-bromo-2,6-difluorophenyl)methyl]-2-chloro-4,6-difluoroaniline |
| SMILES | Fc1cc(F)c(NCc2c(F)ccc(Br)c2F)c(Cl)c1 |
| InChI | InChI=1S/C13H7BrClF4N/c14-8-1-2-10(17)7(12(8)19)5-20-13-9(15)3-6(16)4-11(13)18/h1-4,20H,5H2 |
| InChIKey | JQLNIPSMJRXJBI-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.56 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|