C14H18BrF2NO — CID 106263910
N-[(3-bromo-2,6-difluorophenyl)methyl]-2-(oxan-2-yl)ethanamine (PubChem CID 106263910) has the molecular formula C14H18BrF2NO and a molecular weight of 334.20 g/mol. Its IUPAC name is N-[(3-bromo-2,6-difluorophenyl)methyl]-2-(oxan-2-yl)ethanamine.
| Compound Name | N-[(3-bromo-2,6-difluorophenyl)methyl]-2-(oxan-2-yl)ethanamine |
|---|---|
| PubChem CID | 106263910 |
| Molecular Formula | C14H18BrF2NO |
| Molecular Weight | 334.20 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | N-[(3-bromo-2,6-difluorophenyl)methyl]-2-(oxan-2-yl)ethanamine |
| SMILES | Fc1ccc(Br)c(F)c1CNCCC1CCCCO1 |
| InChI | InChI=1S/C14H18BrF2NO/c15-12-4-5-13(16)11(14(12)17)9-18-7-6-10-3-1-2-8-19-10/h4-5,10,18H,1-3,6-9H2 |
| InChIKey | FKCYCVCRMQZZAC-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.20 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|