C37H44N2O2 — CID 10626459
4-(2,6,6,9,9,18,18,21,21-nonamethyl-2,13-diazapentacyclo[13.8.0.03,12.05,10.017,22]tricosa-1(23),3(12),4,10,13,15,17(22)-heptaen-14-yl)benzoic acid (PubChem CID 10626459) has the molecular formula C37H44N2O2 and a molecular weight of 548.77 g/mol. Its IUPAC name is 4-(2,6,6,9,9,18,18,21,21-nonamethyl-2,13-diazapentacyclo[13.8.0.03,12.05,10.017,22]tricosa-1(23),3(12),4,10,13,15,17(22)-heptaen-14-yl)benzoic acid.
| Compound Name | 4-(2,6,6,9,9,18,18,21,21-nonamethyl-2,13-diazapentacyclo[13.8.0.03,12.05,10.017,22]tricosa-1(23),3(12),4,10,13,15,17(22)-heptaen-14-yl)benzoic acid |
|---|---|
| PubChem CID | 10626459 |
| Molecular Formula | C37H44N2O2 |
| Molecular Weight | 548.77 g/mol |
| Exact Mass | 548.34 |
| IUPAC Name | 4-(2,6,6,9,9,18,18,21,21-nonamethyl-2,13-diazapentacyclo[13.8.0.03,12.05,10.017,22]tricosa-1(23),3(12),4,10,13,15,17(22)-heptaen-14-yl)benzoic acid |
| SMILES | CN1c2cc3c(cc2N=C(c2ccc(C(=O)O)cc2)c2cc4c(cc21)C(C)(C)CCC4(C)C)C(C)(C)CCC3(C)C |
| InChI | InChI=1S/C37H44N2O2/c1-34(2)14-16-36(5,6)27-20-30-24(18-25(27)34)32(22-10-12-23(13-11-22)33(40)41)38-29-19-26-28(21-31(29)39(30)9)37(7,8)17-15-35(26,3)4/h10-13,18-21H,14-17H2,1-9H3,(H,40,41) |
| InChIKey | ZLPRLJSMDSWGCU-UHFFFAOYSA-N |
| XLogP | 9.33 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.77 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |