C33H30N4O5 — CID 10626735
phenyl N-[2,4-dioxo-1-[2-oxo-2-(N-propan-2-ylanilino)ethyl]-5-phenyl-1,5-benzodiazepin-3-yl]carbamate (PubChem CID 10626735) has the molecular formula C33H30N4O5 and a molecular weight of 562.63 g/mol. Its IUPAC name is phenyl N-[2,4-dioxo-1-[2-oxo-2-(N-propan-2-ylanilino)ethyl]-5-phenyl-1,5-benzodiazepin-3-yl]carbamate.
| Compound Name | phenyl N-[2,4-dioxo-1-[2-oxo-2-(N-propan-2-ylanilino)ethyl]-5-phenyl-1,5-benzodiazepin-3-yl]carbamate |
|---|---|
| PubChem CID | 10626735 |
| Molecular Formula | C33H30N4O5 |
| Molecular Weight | 562.63 g/mol |
| Exact Mass | 562.22 |
| IUPAC Name | phenyl N-[2,4-dioxo-1-[2-oxo-2-(N-propan-2-ylanilino)ethyl]-5-phenyl-1,5-benzodiazepin-3-yl]carbamate |
| SMILES | CC(C)N(C(=O)CN1C(=O)C(NC(=O)Oc2ccccc2)C(=O)N(c2ccccc2)c2ccccc21)c1ccccc1 |
| InChI | InChI=1S/C33H30N4O5/c1-23(2)36(24-14-6-3-7-15-24)29(38)22-35-27-20-12-13-21-28(27)37(25-16-8-4-9-17-25)32(40)30(31(35)39)34-33(41)42-26-18-10-5-11-19-26/h3-21,23,30H,22H2,1-2H3,(H,34,41) |
| InChIKey | LXLMOQAAPKOFOG-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.63 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|