C15H15BrF2N2 — CID 106268375
2-(3-bromo-2,6-difluorophenyl)-1-(3,5-dimethyl-2-pyridinyl)ethanamine (PubChem CID 106268375) has the molecular formula C15H15BrF2N2 and a molecular weight of 341.20 g/mol. Its IUPAC name is 2-(3-bromo-2,6-difluorophenyl)-1-(3,5-dimethyl-2-pyridinyl)ethanamine.
| Compound Name | 2-(3-bromo-2,6-difluorophenyl)-1-(3,5-dimethyl-2-pyridinyl)ethanamine |
|---|---|
| PubChem CID | 106268375 |
| Molecular Formula | C15H15BrF2N2 |
| Molecular Weight | 341.20 g/mol |
| Exact Mass | 340.04 |
| IUPAC Name | 2-(3-bromo-2,6-difluorophenyl)-1-(3,5-dimethyl-2-pyridinyl)ethanamine |
| SMILES | Cc1cnc(C(N)Cc2c(F)ccc(Br)c2F)c(C)c1 |
| InChI | InChI=1S/C15H15BrF2N2/c1-8-5-9(2)15(20-7-8)13(19)6-10-12(17)4-3-11(16)14(10)18/h3-5,7,13H,6,19H2,1-2H3 |
| InChIKey | ZIWNYYKJMPVNIF-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.20 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|