About 5-cyano-N-(5,5,5-trifluoropentyl)thiophene-2-sulfonamide
5-cyano-N-(5,5,5-trifluoropentyl)thiophene-2-sulfonamide (PubChem CID 106268773) has the molecular formula C10H11F3N2O2S2
and a molecular weight of 312.34 g/mol. Its IUPAC name is 5-cyano-N-(5,5,5-trifluoropentyl)thiophene-2-sulfonamide.
Molecular Properties
| Compound Name | 5-cyano-N-(5,5,5-trifluoropentyl)thiophene-2-sulfonamide |
| PubChem CID | 106268773 |
| Molecular Formula | C10H11F3N2O2S2 |
| Molecular Weight | 312.34 g/mol |
| Exact Mass | 312.02 |
| IUPAC Name | 5-cyano-N-(5,5,5-trifluoropentyl)thiophene-2-sulfonamide |
| SMILES | N#Cc1ccc(S(=O)(=O)NCCCCC(F)(F)F)s1 |
| InChI | InChI=1S/C10H11F3N2O2S2/c11-10(12,13)5-1-2-6-15-19(16,17)9-4-3-8(7-14)18-9/h3-4,15H,1-2,5-6H2 |
| InChIKey | QTFNVTXUHXEELL-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.34 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-cyano-N-(5,5,5-trifluoropentyl)thiophene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyano-N-(5,5,5-trifluoropentyl)thiophene-2-sulfonamide?
The IUPAC name of 5-cyano-N-(5,5,5-trifluoropentyl)thiophene-2-sulfonamide (CID 106268773) is 5-cyano-N-(5,5,5-trifluoropentyl)thiophene-2-sulfonamide.
What is the SMILES notation for 5-cyano-N-(5,5,5-trifluoropentyl)thiophene-2-sulfonamide?
The canonical SMILES for 5-cyano-N-(5,5,5-trifluoropentyl)thiophene-2-sulfonamide is N#Cc1ccc(S(=O)(=O)NCCCCC(F)(F)F)s1.
What is the InChIKey of 5-cyano-N-(5,5,5-trifluoropentyl)thiophene-2-sulfonamide?
The InChIKey is QTFNVTXUHXEELL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11F3N2O2S2/c11-10(12,13)5-1-2-6-15-19(16,17)9-4-3-8(7-14)18-9/h3-4,15H,1-2,5-6H2.
What are the key properties of 5-cyano-N-(5,5,5-trifluoropentyl)thiophene-2-sulfonamide?
5-cyano-N-(5,5,5-trifluoropentyl)thiophene-2-sulfonamide has a molecular weight of 312.34 g/mol, XLogP of 2.63, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyano-N-(5,5,5-trifluoropentyl)thiophene-2-sulfonamide is sourced from PubChem (CID 106268773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).