About [3-[[methyl-[3-(4-oxo-2-phenylchromen-7-yl)oxypropyl]amino]methyl]phenyl] N-heptylcarbamate
[3-[[methyl-[3-(4-oxo-2-phenylchromen-7-yl)oxypropyl]amino]methyl]phenyl] N-heptylcarbamate (PubChem CID 10627292) has the molecular formula C34H40N2O5
and a molecular weight of 556.70 g/mol. Its IUPAC name is [3-[[methyl-[3-(4-oxo-2-phenylchromen-7-yl)oxypropyl]amino]methyl]phenyl] N-heptylcarbamate.
Molecular Properties
| Compound Name | [3-[[methyl-[3-(4-oxo-2-phenylchromen-7-yl)oxypropyl]amino]methyl]phenyl] N-heptylcarbamate |
| PubChem CID | 10627292 |
| Molecular Formula | C34H40N2O5 |
| Molecular Weight | 556.70 g/mol |
| Exact Mass | 556.29 |
| IUPAC Name | [3-[[methyl-[3-(4-oxo-2-phenylchromen-7-yl)oxypropyl]amino]methyl]phenyl] N-heptylcarbamate |
| SMILES | CCCCCCCNC(=O)Oc1cccc(CN(C)CCCOc2ccc3c(=O)cc(-c4ccccc4)oc3c2)c1 |
| InChI | InChI=1S/C34H40N2O5/c1-3-4-5-6-10-19-35-34(38)40-29-16-11-13-26(22-29)25-36(2)20-12-21-39-28-17-18-30-31(37)24-32(41-33(30)23-28)27-14-8-7-9-15-27/h7-9,11,13-18,22-24H,3-6,10,12,19-21,25H2,1-2H3,(H,35,38) |
| InChIKey | OSYZGMFZNVGFEI-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 556.70 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [3-[[methyl-[3-(4-oxo-2-phenylchromen-7-yl)oxypropyl]amino]methyl]phenyl] N-heptylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[[methyl-[3-(4-oxo-2-phenylchromen-7-yl)oxypropyl]amino]methyl]phenyl] N-heptylcarbamate?
The IUPAC name of [3-[[methyl-[3-(4-oxo-2-phenylchromen-7-yl)oxypropyl]amino]methyl]phenyl] N-heptylcarbamate (CID 10627292) is [3-[[methyl-[3-(4-oxo-2-phenylchromen-7-yl)oxypropyl]amino]methyl]phenyl] N-heptylcarbamate.
What is the SMILES notation for [3-[[methyl-[3-(4-oxo-2-phenylchromen-7-yl)oxypropyl]amino]methyl]phenyl] N-heptylcarbamate?
The canonical SMILES for [3-[[methyl-[3-(4-oxo-2-phenylchromen-7-yl)oxypropyl]amino]methyl]phenyl] N-heptylcarbamate is CCCCCCCNC(=O)Oc1cccc(CN(C)CCCOc2ccc3c(=O)cc(-c4ccccc4)oc3c2)c1.
What is the InChIKey of [3-[[methyl-[3-(4-oxo-2-phenylchromen-7-yl)oxypropyl]amino]methyl]phenyl] N-heptylcarbamate?
The InChIKey is OSYZGMFZNVGFEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C34H40N2O5/c1-3-4-5-6-10-19-35-34(38)40-29-16-11-13-26(22-29)25-36(2)20-12-21-39-28-17-18-30-31(37)24-32(41-33(30)23-28)27-14-8-7-9-15-27/h7-9,11,13-18,22-24H,3-6,10,12,19-21,25H2,1-2H3,(H,35,38).
What are the key properties of [3-[[methyl-[3-(4-oxo-2-phenylchromen-7-yl)oxypropyl]amino]methyl]phenyl] N-heptylcarbamate?
[3-[[methyl-[3-(4-oxo-2-phenylchromen-7-yl)oxypropyl]amino]methyl]phenyl] N-heptylcarbamate has a molecular weight of 556.70 g/mol, XLogP of 7.42, 15 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[[methyl-[3-(4-oxo-2-phenylchromen-7-yl)oxypropyl]amino]methyl]phenyl] N-heptylcarbamate is sourced from PubChem (CID 10627292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).