C16H21BrF2N2 — CID 106273284
1-[(3-bromo-2,6-difluorophenyl)methyl]-2-cyclopropyl-2,5-dimethylpiperazine (PubChem CID 106273284) has the molecular formula C16H21BrF2N2 and a molecular weight of 359.26 g/mol. Its IUPAC name is 1-[(3-bromo-2,6-difluorophenyl)methyl]-2-cyclopropyl-2,5-dimethylpiperazine.
| Compound Name | 1-[(3-bromo-2,6-difluorophenyl)methyl]-2-cyclopropyl-2,5-dimethylpiperazine |
|---|---|
| PubChem CID | 106273284 |
| Molecular Formula | C16H21BrF2N2 |
| Molecular Weight | 359.26 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | 1-[(3-bromo-2,6-difluorophenyl)methyl]-2-cyclopropyl-2,5-dimethylpiperazine |
| SMILES | CC1CN(Cc2c(F)ccc(Br)c2F)C(C)(C2CC2)CN1 |
| InChI | InChI=1S/C16H21BrF2N2/c1-10-7-21(16(2,9-20-10)11-3-4-11)8-12-14(18)6-5-13(17)15(12)19/h5-6,10-11,20H,3-4,7-9H2,1-2H3 |
| InChIKey | QDLQQXXNKRZQHV-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.26 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|