C12H17N3O3 — CID 106274538
2-amino-N-(3-amino-2,2-dimethyl-3-oxopropyl)-5-hydroxybenzamide (PubChem CID 106274538) has the molecular formula C12H17N3O3 and a molecular weight of 251.29 g/mol. Its IUPAC name is 2-amino-N-(3-amino-2,2-dimethyl-3-oxopropyl)-5-hydroxybenzamide.
| Compound Name | 2-amino-N-(3-amino-2,2-dimethyl-3-oxopropyl)-5-hydroxybenzamide |
|---|---|
| PubChem CID | 106274538 |
| Molecular Formula | C12H17N3O3 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 2-amino-N-(3-amino-2,2-dimethyl-3-oxopropyl)-5-hydroxybenzamide |
| SMILES | CC(C)(CNC(=O)c1cc(O)ccc1N)C(N)=O |
| InChI | InChI=1S/C12H17N3O3/c1-12(2,11(14)18)6-15-10(17)8-5-7(16)3-4-9(8)13/h3-5,16H,6,13H2,1-2H3,(H2,14,18)(H,15,17) |
| InChIKey | FQIPVOFGMURKHB-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 118.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|