C15H23N3O3 — CID 106274654
3-[3-(2-aminophenoxy)propanoylamino]-N,2,2-trimethylpropanamide (PubChem CID 106274654) has the molecular formula C15H23N3O3 and a molecular weight of 293.37 g/mol. Its IUPAC name is 3-[3-(2-aminophenoxy)propanoylamino]-N,2,2-trimethylpropanamide.
| Compound Name | 3-[3-(2-aminophenoxy)propanoylamino]-N,2,2-trimethylpropanamide |
|---|---|
| PubChem CID | 106274654 |
| Molecular Formula | C15H23N3O3 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | 3-[3-(2-aminophenoxy)propanoylamino]-N,2,2-trimethylpropanamide |
| SMILES | CNC(=O)C(C)(C)CNC(=O)CCOc1ccccc1N |
| InChI | InChI=1S/C15H23N3O3/c1-15(2,14(20)17-3)10-18-13(19)8-9-21-12-7-5-4-6-11(12)16/h4-7H,8-10,16H2,1-3H3,(H,17,20)(H,18,19) |
| InChIKey | JVIWFKFFRCMJKV-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|