C11H23N3O — CID 106274757
3-[(3-aminocyclohexyl)amino]-2,2-dimethylpropanamide (PubChem CID 106274757) has the molecular formula C11H23N3O and a molecular weight of 213.32 g/mol. Its IUPAC name is 3-[(3-aminocyclohexyl)amino]-2,2-dimethylpropanamide.
| Compound Name | 3-[(3-aminocyclohexyl)amino]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 106274757 |
| Molecular Formula | C11H23N3O |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.18 |
| IUPAC Name | 3-[(3-aminocyclohexyl)amino]-2,2-dimethylpropanamide |
| SMILES | CC(C)(CNC1CCCC(N)C1)C(N)=O |
| InChI | InChI=1S/C11H23N3O/c1-11(2,10(13)15)7-14-9-5-3-4-8(12)6-9/h8-9,14H,3-7,12H2,1-2H3,(H2,13,15) |
| InChIKey | OZDGVPANFKEEGR-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |