C34H41ClN2O4S — CID 10627542
7-[7-(2-chloroethoxy)-6-methoxy-3,4-dihydro-1H-isoquinolin-2-yl]-2-(3,4-dimethoxyphenyl)-2-(4-methylphenyl)sulfanylheptanenitrile (PubChem CID 10627542) has the molecular formula C34H41ClN2O4S and a molecular weight of 609.23 g/mol. Its IUPAC name is 7-[7-(2-chloroethoxy)-6-methoxy-3,4-dihydro-1H-isoquinolin-2-yl]-2-(3,4-dimethoxyphenyl)-2-(4-methylphenyl)sulfanylheptanenitrile.
| Compound Name | 7-[7-(2-chloroethoxy)-6-methoxy-3,4-dihydro-1H-isoquinolin-2-yl]-2-(3,4-dimethoxyphenyl)-2-(4-methylphenyl)sulfanylheptanenitrile |
|---|---|
| PubChem CID | 10627542 |
| Molecular Formula | C34H41ClN2O4S |
| Molecular Weight | 609.23 g/mol |
| Exact Mass | 608.25 |
| IUPAC Name | 7-[7-(2-chloroethoxy)-6-methoxy-3,4-dihydro-1H-isoquinolin-2-yl]-2-(3,4-dimethoxyphenyl)-2-(4-methylphenyl)sulfanylheptanenitrile |
| SMILES | COc1ccc(C(C#N)(CCCCCN2CCc3cc(OC)c(OCCCl)cc3C2)Sc2ccc(C)cc2)cc1OC |
| InChI | InChI=1S/C34H41ClN2O4S/c1-25-8-11-29(12-9-25)42-34(24-36,28-10-13-30(38-2)32(22-28)40-4)15-6-5-7-17-37-18-14-26-20-31(39-3)33(41-19-16-35)21-27(26)23-37/h8-13,20-22H,5-7,14-19,23H2,1-4H3 |
| InChIKey | XJJRDDRVPIDPGW-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 63.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.23 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|