C39H41N5O2 — CID 10627576
N-[3-[3-[(1,5-dimethylacridine-4-carbonyl)amino]propyl-methylamino]propyl]-1,5-dimethylacridine-4-carboxamide (PubChem CID 10627576) has the molecular formula C39H41N5O2 and a molecular weight of 611.79 g/mol. Its IUPAC name is N-[3-[3-[(1,5-dimethylacridine-4-carbonyl)amino]propyl-methylamino]propyl]-1,5-dimethylacridine-4-carboxamide.
| Compound Name | N-[3-[3-[(1,5-dimethylacridine-4-carbonyl)amino]propyl-methylamino]propyl]-1,5-dimethylacridine-4-carboxamide |
|---|---|
| PubChem CID | 10627576 |
| Molecular Formula | C39H41N5O2 |
| Molecular Weight | 611.79 g/mol |
| Exact Mass | 611.33 |
| IUPAC Name | N-[3-[3-[(1,5-dimethylacridine-4-carbonyl)amino]propyl-methylamino]propyl]-1,5-dimethylacridine-4-carboxamide |
| SMILES | Cc1ccc(C(=O)NCCCN(C)CCCNC(=O)c2ccc(C)c3cc4cccc(C)c4nc23)c2nc3c(C)cccc3cc12 |
| InChI | InChI=1S/C39H41N5O2/c1-24-14-16-30(36-32(24)22-28-12-6-10-26(3)34(28)42-36)38(45)40-18-8-20-44(5)21-9-19-41-39(46)31-17-15-25(2)33-23-29-13-7-11-27(4)35(29)43-37(31)33/h6-7,10-17,22-23H,8-9,18-21H2,1-5H3,(H,40,45)(H,41,46) |
| InChIKey | QILJHQDEWQGQAX-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.79 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|