C14H21N3O2 — CID 106276098
3-[[2-(benzylamino)-2-oxoethyl]amino]-2,2-dimethylpropanamide (PubChem CID 106276098) has the molecular formula C14H21N3O2 and a molecular weight of 263.34 g/mol. Its IUPAC name is 3-[[2-(benzylamino)-2-oxoethyl]amino]-2,2-dimethylpropanamide.
| Compound Name | 3-[[2-(benzylamino)-2-oxoethyl]amino]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 106276098 |
| Molecular Formula | C14H21N3O2 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.16 |
| IUPAC Name | 3-[[2-(benzylamino)-2-oxoethyl]amino]-2,2-dimethylpropanamide |
| SMILES | CC(C)(CNCC(=O)NCc1ccccc1)C(N)=O |
| InChI | InChI=1S/C14H21N3O2/c1-14(2,13(15)19)10-16-9-12(18)17-8-11-6-4-3-5-7-11/h3-7,16H,8-10H2,1-2H3,(H2,15,19)(H,17,18) |
| InChIKey | NHRKUSOLYCLGFJ-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |