C28H22F6O9 — CID 10627624
methyl 15-acetyl-3,13-dihydroxy-7,12-bis[(2,2,2-trifluoroacetyl)oxy]undecacyclo[9.9.0.02,9.03,7.04,20.05,18.06,16.08,15.010,14.012,19.013,17]icosane-1-carboxylate (PubChem CID 10627624) has the molecular formula C28H22F6O9 and a molecular weight of 616.46 g/mol. Its IUPAC name is methyl 15-acetyl-3,13-dihydroxy-7,12-bis[(2,2,2-trifluoroacetyl)oxy]undecacyclo[9.9.0.02,9.03,7.04,20.05,18.06,16.08,15.010,14.012,19.013,17]icosane-1-carboxylate.
| Compound Name | methyl 15-acetyl-3,13-dihydroxy-7,12-bis[(2,2,2-trifluoroacetyl)oxy]undecacyclo[9.9.0.02,9.03,7.04,20.05,18.06,16.08,15.010,14.012,19.013,17]icosane-1-carboxylate |
|---|---|
| PubChem CID | 10627624 |
| Molecular Formula | C28H22F6O9 |
| Molecular Weight | 616.46 g/mol |
| Exact Mass | 616.12 |
| IUPAC Name | methyl 15-acetyl-3,13-dihydroxy-7,12-bis[(2,2,2-trifluoroacetyl)oxy]undecacyclo[9.9.0.02,9.03,7.04,20.05,18.06,16.08,15.010,14.012,19.013,17]icosane-1-carboxylate |
| SMILES | COC(=O)C12C3C4C5C6C7C8C5C5(OC(=O)C(F)(F)F)C9C(C%10C(C89C(C)=O)C7(O)C(OC(=O)C(F)(F)F)(C63)C%101)C2C45O |
| InChI | InChI=1S/C28H22F6O9/c1-3(35)21-12-8-4-5-9-13-11(4)26(43-20(38)28(32,33)34)17-6(14(21)23(8,26)39)7-15(22(13,17)18(36)41-2)24(9,40)25(10(5)12,16(7)21)42-19(37)27(29,30)31/h4-17,39-40H,1-2H3 |
| InChIKey | KVYPEHWUGRRAEI-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 136.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.46 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|