C15H19N3OS — CID 106276756
N,2,2-trimethyl-3-(4-phenyl-2-sulfanylidene-1H-imidazol-3-yl)propanamide (PubChem CID 106276756) has the molecular formula C15H19N3OS and a molecular weight of 289.40 g/mol. Its IUPAC name is N,2,2-trimethyl-3-(4-phenyl-2-sulfanylidene-1H-imidazol-3-yl)propanamide.
| Compound Name | N,2,2-trimethyl-3-(4-phenyl-2-sulfanylidene-1H-imidazol-3-yl)propanamide |
|---|---|
| PubChem CID | 106276756 |
| Molecular Formula | C15H19N3OS |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | N,2,2-trimethyl-3-(4-phenyl-2-sulfanylidene-1H-imidazol-3-yl)propanamide |
| SMILES | CNC(=O)C(C)(C)Cn1c(-c2ccccc2)c[nH]c1=S |
| InChI | InChI=1S/C15H19N3OS/c1-15(2,13(19)16-3)10-18-12(9-17-14(18)20)11-7-5-4-6-8-11/h4-9H,10H2,1-3H3,(H,16,19)(H,17,20) |
| InChIKey | ULGZHZXZNAHZII-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 49.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|