C39H62O6 — CID 10627759
methyl (4aR,5R,6aR,6aS,6bR,8aR,10S,12aR,14bR)-5,10-di(butanoyloxy)-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate (PubChem CID 10627759) has the molecular formula C39H62O6 and a molecular weight of 626.92 g/mol. Its IUPAC name is methyl (4aR,5R,6aR,6aS,6bR,8aR,10S,12aR,14bR)-5,10-di(butanoyloxy)-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate.
| Compound Name | methyl (4aR,5R,6aR,6aS,6bR,8aR,10S,12aR,14bR)-5,10-di(butanoyloxy)-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate |
|---|---|
| PubChem CID | 10627759 |
| Molecular Formula | C39H62O6 |
| Molecular Weight | 626.92 g/mol |
| Exact Mass | 626.45 |
| IUPAC Name | methyl (4aR,5R,6aR,6aS,6bR,8aR,10S,12aR,14bR)-5,10-di(butanoyloxy)-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate |
| SMILES | CCCC(=O)O[C@H]1CC[C@]2(C)[C@H]3CC=C4[C@H]5CC(C)(C)CC[C@]5(C(=O)OC)[C@H](OC(=O)CCC)C[C@@]4(C)[C@]3(C)CC[C@H]2C1(C)C |
| InChI | InChI=1S/C39H62O6/c1-11-13-31(40)44-29-18-19-36(7)27(35(29,5)6)17-20-37(8)28(36)16-15-25-26-23-34(3,4)21-22-39(26,33(42)43-10)30(24-38(25,37)9)45-32(41)14-12-2/h15,26-30H,11-14,16-24H2,1-10H3/t26-,27+,28-,29+,30-,36+,37-,38-,39-/m1/s1 |
| InChIKey | OWYZSZOAYIZNEY-AOWDRKLESA-N |
| XLogP | 8.99 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.92 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|