C35H35Cl2N5O2 — CID 10627771
1-[4,7-bis(7-chloroquinolin-4-yl)-1,4,7-triazonan-1-yl]-4-phenylmethoxybutan-1-one (PubChem CID 10627771) has the molecular formula C35H35Cl2N5O2 and a molecular weight of 628.60 g/mol. Its IUPAC name is 1-[4,7-bis(7-chloroquinolin-4-yl)-1,4,7-triazonan-1-yl]-4-phenylmethoxybutan-1-one.
| Compound Name | 1-[4,7-bis(7-chloroquinolin-4-yl)-1,4,7-triazonan-1-yl]-4-phenylmethoxybutan-1-one |
|---|---|
| PubChem CID | 10627771 |
| Molecular Formula | C35H35Cl2N5O2 |
| Molecular Weight | 628.60 g/mol |
| Exact Mass | 627.22 |
| IUPAC Name | 1-[4,7-bis(7-chloroquinolin-4-yl)-1,4,7-triazonan-1-yl]-4-phenylmethoxybutan-1-one |
| SMILES | O=C(CCCOCc1ccccc1)N1CCN(c2ccnc3cc(Cl)ccc23)CCN(c2ccnc3cc(Cl)ccc23)CC1 |
| InChI | InChI=1S/C35H35Cl2N5O2/c36-27-8-10-29-31(23-27)38-14-12-33(29)40-16-17-41(34-13-15-39-32-24-28(37)9-11-30(32)34)19-21-42(20-18-40)35(43)7-4-22-44-25-26-5-2-1-3-6-26/h1-3,5-6,8-15,23-24H,4,7,16-22,25H2 |
| InChIKey | SFKBJBVNYNJFSK-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 61.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.60 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|