C11H20N4O — CID 106278377
3-[(1-ethylimidazol-2-yl)amino]-N,2,2-trimethylpropanamide (PubChem CID 106278377) has the molecular formula C11H20N4O and a molecular weight of 224.31 g/mol. Its IUPAC name is 3-[(1-ethylimidazol-2-yl)amino]-N,2,2-trimethylpropanamide.
| Compound Name | 3-[(1-ethylimidazol-2-yl)amino]-N,2,2-trimethylpropanamide |
|---|---|
| PubChem CID | 106278377 |
| Molecular Formula | C11H20N4O |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | 3-[(1-ethylimidazol-2-yl)amino]-N,2,2-trimethylpropanamide |
| SMILES | CCn1ccnc1NCC(C)(C)C(=O)NC |
| InChI | InChI=1S/C11H20N4O/c1-5-15-7-6-13-10(15)14-8-11(2,3)9(16)12-4/h6-7H,5,8H2,1-4H3,(H,12,16)(H,13,14) |
| InChIKey | OQZDLJZFOVLCFB-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |