C38H63N7O2 — CID 10628017
11-[4-[6-[8-[6-aminohexyl(methyl)amino]octyl-methylamino]hexylamino]butanoyl]-5H-pyrido[2,3-b][1,4]benzodiazepin-6-one (PubChem CID 10628017) has the molecular formula C38H63N7O2 and a molecular weight of 649.97 g/mol. Its IUPAC name is 11-[4-[6-[8-[6-aminohexyl(methyl)amino]octyl-methylamino]hexylamino]butanoyl]-5H-pyrido[2,3-b][1,4]benzodiazepin-6-one.
| Compound Name | 11-[4-[6-[8-[6-aminohexyl(methyl)amino]octyl-methylamino]hexylamino]butanoyl]-5H-pyrido[2,3-b][1,4]benzodiazepin-6-one |
|---|---|
| PubChem CID | 10628017 |
| Molecular Formula | C38H63N7O2 |
| Molecular Weight | 649.97 g/mol |
| Exact Mass | 649.50 |
| IUPAC Name | 11-[4-[6-[8-[6-aminohexyl(methyl)amino]octyl-methylamino]hexylamino]butanoyl]-5H-pyrido[2,3-b][1,4]benzodiazepin-6-one |
| SMILES | CN(CCCCCCN)CCCCCCCCN(C)CCCCCCNCCCC(=O)N1c2ccccc2C(=O)Nc2cccnc21 |
| InChI | InChI=1S/C38H63N7O2/c1-43(31-17-9-5-13-25-39)29-15-7-3-4-8-16-30-44(2)32-18-10-6-14-26-40-27-20-24-36(46)45-35-23-12-11-21-33(35)38(47)42-34-22-19-28-41-37(34)45/h11-12,19,21-23,28,40H,3-10,13-18,20,24-27,29-32,39H2,1-2H3,(H,42,47) |
| InChIKey | SZPRVUSSTLSOHX-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 106.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.97 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|