C11H12F3N5 — CID 106281310
1-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]-2-(trifluoromethyl)benzene-1,4-diamine (PubChem CID 106281310) has the molecular formula C11H12F3N5 and a molecular weight of 271.25 g/mol. Its IUPAC name is 1-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]-2-(trifluoromethyl)benzene-1,4-diamine.
| Compound Name | 1-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]-2-(trifluoromethyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 106281310 |
| Molecular Formula | C11H12F3N5 |
| Molecular Weight | 271.25 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 1-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]-2-(trifluoromethyl)benzene-1,4-diamine |
| SMILES | CC(Nc1ccc(N)cc1C(F)(F)F)c1ncn[nH]1 |
| InChI | InChI=1S/C11H12F3N5/c1-6(10-16-5-17-19-10)18-9-3-2-7(15)4-8(9)11(12,13)14/h2-6,18H,15H2,1H3,(H,16,17,19) |
| InChIKey | IDNPTTHLJJOTSD-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.25 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|