C12H15FN4O — CID 106282053
4-fluoro-2-[1-[1-(1H-1,2,4-triazol-5-yl)ethylamino]ethyl]phenol (PubChem CID 106282053) has the molecular formula C12H15FN4O and a molecular weight of 250.28 g/mol. Its IUPAC name is 4-fluoro-2-[1-[1-(1H-1,2,4-triazol-5-yl)ethylamino]ethyl]phenol.
| Compound Name | 4-fluoro-2-[1-[1-(1H-1,2,4-triazol-5-yl)ethylamino]ethyl]phenol |
|---|---|
| PubChem CID | 106282053 |
| Molecular Formula | C12H15FN4O |
| Molecular Weight | 250.28 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 4-fluoro-2-[1-[1-(1H-1,2,4-triazol-5-yl)ethylamino]ethyl]phenol |
| SMILES | CC(NC(C)c1cc(F)ccc1O)c1ncn[nH]1 |
| InChI | InChI=1S/C12H15FN4O/c1-7(10-5-9(13)3-4-11(10)18)16-8(2)12-14-6-15-17-12/h3-8,16,18H,1-2H3,(H,14,15,17) |
| InChIKey | ZSRCRQIUEUFRHI-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.28 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|