C15H23N5 — CID 106282512
2,6,6-trimethyl-1-[1-(1H-1,2,4-triazol-5-yl)ethyl]-5,7-dihydro-4H-indol-4-amine (PubChem CID 106282512) has the molecular formula C15H23N5 and a molecular weight of 273.38 g/mol. Its IUPAC name is 2,6,6-trimethyl-1-[1-(1H-1,2,4-triazol-5-yl)ethyl]-5,7-dihydro-4H-indol-4-amine.
| Compound Name | 2,6,6-trimethyl-1-[1-(1H-1,2,4-triazol-5-yl)ethyl]-5,7-dihydro-4H-indol-4-amine |
|---|---|
| PubChem CID | 106282512 |
| Molecular Formula | C15H23N5 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.20 |
| IUPAC Name | 2,6,6-trimethyl-1-[1-(1H-1,2,4-triazol-5-yl)ethyl]-5,7-dihydro-4H-indol-4-amine |
| SMILES | Cc1cc2c(n1C(C)c1ncn[nH]1)CC(C)(C)CC2N |
| InChI | InChI=1S/C15H23N5/c1-9-5-11-12(16)6-15(3,4)7-13(11)20(9)10(2)14-17-8-18-19-14/h5,8,10,12H,6-7,16H2,1-4H3,(H,17,18,19) |
| InChIKey | BCKWEFFJNDUINU-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |