C11H12N8 — CID 106282877
1-phenyl-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]tetrazol-5-amine (PubChem CID 106282877) has the molecular formula C11H12N8 and a molecular weight of 256.27 g/mol. Its IUPAC name is 1-phenyl-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]tetrazol-5-amine.
| Compound Name | 1-phenyl-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]tetrazol-5-amine |
|---|---|
| PubChem CID | 106282877 |
| Molecular Formula | C11H12N8 |
| Molecular Weight | 256.27 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 1-phenyl-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]tetrazol-5-amine |
| SMILES | CC(Nc1nnnn1-c1ccccc1)c1ncn[nH]1 |
| InChI | InChI=1S/C11H12N8/c1-8(10-12-7-13-15-10)14-11-16-17-18-19(11)9-5-3-2-4-6-9/h2-8H,1H3,(H,12,13,15)(H,14,16,18) |
| InChIKey | DKYVSGXVYDSYQB-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 97.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.27 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |