C14H27N3O — CID 106284688
3-ethyl-1-[(3-propylimidazol-4-yl)methylamino]pentan-2-ol (PubChem CID 106284688) has the molecular formula C14H27N3O and a molecular weight of 253.39 g/mol. Its IUPAC name is 3-ethyl-1-[(3-propylimidazol-4-yl)methylamino]pentan-2-ol.
| Compound Name | 3-ethyl-1-[(3-propylimidazol-4-yl)methylamino]pentan-2-ol |
|---|---|
| PubChem CID | 106284688 |
| Molecular Formula | C14H27N3O |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.22 |
| IUPAC Name | 3-ethyl-1-[(3-propylimidazol-4-yl)methylamino]pentan-2-ol |
| SMILES | CCCn1cncc1CNCC(O)C(CC)CC |
| InChI | InChI=1S/C14H27N3O/c1-4-7-17-11-16-9-13(17)8-15-10-14(18)12(5-2)6-3/h9,11-12,14-15,18H,4-8,10H2,1-3H3 |
| InChIKey | MJLMLGRCKBCYSG-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |