C17H21N3S — CID 106284803
5-pentan-3-yl-N-quinolin-5-yl-4,5-dihydro-1,3-thiazol-2-amine (PubChem CID 106284803) has the molecular formula C17H21N3S and a molecular weight of 299.44 g/mol. Its IUPAC name is 5-pentan-3-yl-N-quinolin-5-yl-4,5-dihydro-1,3-thiazol-2-amine.
| Compound Name | 5-pentan-3-yl-N-quinolin-5-yl-4,5-dihydro-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 106284803 |
| Molecular Formula | C17H21N3S |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 5-pentan-3-yl-N-quinolin-5-yl-4,5-dihydro-1,3-thiazol-2-amine |
| SMILES | CCC(CC)C1CN=C(Nc2cccc3ncccc23)S1 |
| InChI | InChI=1S/C17H21N3S/c1-3-12(4-2)16-11-19-17(21-16)20-15-9-5-8-14-13(15)7-6-10-18-14/h5-10,12,16H,3-4,11H2,1-2H3,(H,19,20) |
| InChIKey | AVUCCYHPBDVMRB-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |