About N-methyl-2-[(5-pentan-3-yl-4,5-dihydro-1,3-thiazol-2-yl)amino]propanamide
N-methyl-2-[(5-pentan-3-yl-4,5-dihydro-1,3-thiazol-2-yl)amino]propanamide (PubChem CID 106285002) has the molecular formula C12H23N3OS
and a molecular weight of 257.40 g/mol. Its IUPAC name is N-methyl-2-[(5-pentan-3-yl-4,5-dihydro-1,3-thiazol-2-yl)amino]propanamide.
Molecular Properties
| Compound Name | N-methyl-2-[(5-pentan-3-yl-4,5-dihydro-1,3-thiazol-2-yl)amino]propanamide |
| PubChem CID | 106285002 |
| Molecular Formula | C12H23N3OS |
| Molecular Weight | 257.40 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | N-methyl-2-[(5-pentan-3-yl-4,5-dihydro-1,3-thiazol-2-yl)amino]propanamide |
| SMILES | CCC(CC)C1CN=C(NC(C)C(=O)NC)S1 |
| InChI | InChI=1S/C12H23N3OS/c1-5-9(6-2)10-7-14-12(17-10)15-8(3)11(16)13-4/h8-10H,5-7H2,1-4H3,(H,13,16)(H,14,15) |
| InChIKey | SMCPHDZHVCGTCG-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.40 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-methyl-2-[(5-pentan-3-yl-4,5-dihydro-1,3-thiazol-2-yl)amino]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-2-[(5-pentan-3-yl-4,5-dihydro-1,3-thiazol-2-yl)amino]propanamide?
The IUPAC name of N-methyl-2-[(5-pentan-3-yl-4,5-dihydro-1,3-thiazol-2-yl)amino]propanamide (CID 106285002) is N-methyl-2-[(5-pentan-3-yl-4,5-dihydro-1,3-thiazol-2-yl)amino]propanamide.
What is the SMILES notation for N-methyl-2-[(5-pentan-3-yl-4,5-dihydro-1,3-thiazol-2-yl)amino]propanamide?
The canonical SMILES for N-methyl-2-[(5-pentan-3-yl-4,5-dihydro-1,3-thiazol-2-yl)amino]propanamide is CCC(CC)C1CN=C(NC(C)C(=O)NC)S1.
What is the InChIKey of N-methyl-2-[(5-pentan-3-yl-4,5-dihydro-1,3-thiazol-2-yl)amino]propanamide?
The InChIKey is SMCPHDZHVCGTCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23N3OS/c1-5-9(6-2)10-7-14-12(17-10)15-8(3)11(16)13-4/h8-10H,5-7H2,1-4H3,(H,13,16)(H,14,15).
What are the key properties of N-methyl-2-[(5-pentan-3-yl-4,5-dihydro-1,3-thiazol-2-yl)amino]propanamide?
N-methyl-2-[(5-pentan-3-yl-4,5-dihydro-1,3-thiazol-2-yl)amino]propanamide has a molecular weight of 257.40 g/mol, XLogP of 1.62, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-2-[(5-pentan-3-yl-4,5-dihydro-1,3-thiazol-2-yl)amino]propanamide is sourced from PubChem (CID 106285002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).