C44H54O4Si2 — CID 10628522
(2R,3S)-1,4-bis[[tert-butyl(diphenyl)silyl]oxy]-2-methyl-3-phenylmethoxybutan-2-ol (PubChem CID 10628522) has the molecular formula C44H54O4Si2 and a molecular weight of 703.08 g/mol. Its IUPAC name is (2R,3S)-1,4-bis[[tert-butyl(diphenyl)silyl]oxy]-2-methyl-3-phenylmethoxybutan-2-ol.
| Compound Name | (2R,3S)-1,4-bis[[tert-butyl(diphenyl)silyl]oxy]-2-methyl-3-phenylmethoxybutan-2-ol |
|---|---|
| PubChem CID | 10628522 |
| Molecular Formula | C44H54O4Si2 |
| Molecular Weight | 703.08 g/mol |
| Exact Mass | 702.36 |
| IUPAC Name | (2R,3S)-1,4-bis[[tert-butyl(diphenyl)silyl]oxy]-2-methyl-3-phenylmethoxybutan-2-ol |
| SMILES | CC(C)(C)[Si](OC[C@H](OCc1ccccc1)[C@](C)(O)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C44H54O4Si2/c1-42(2,3)49(37-25-15-9-16-26-37,38-27-17-10-18-28-38)47-34-41(46-33-36-23-13-8-14-24-36)44(7,45)35-48-50(43(4,5)6,39-29-19-11-20-30-39)40-31-21-12-22-32-40/h8-32,41,45H,33-35H2,1-7H3/t41-,44+/m0/s1 |
| InChIKey | UEJHBTVPSMSILU-HTOSQESHSA-N |
| XLogP | 7.48 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.08 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|